C25H22BrF3N4O2 — CID 58525033
1-[4-(4-acetylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]-9-bromo-2,4-dihydropyrazino[2,3-c]quinolin-3-one (PubChem CID 58525033) has the molecular formula C25H22BrF3N4O2 and a molecular weight of 547.38 g/mol. Its IUPAC name is 1-[4-(4-acetylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]-9-bromo-2,4-dihydropyrazino[2,3-c]quinolin-3-one.
| Compound Name | 1-[4-(4-acetylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]-9-bromo-2,4-dihydropyrazino[2,3-c]quinolin-3-one |
|---|---|
| PubChem CID | 58525033 |
| Molecular Formula | C25H22BrF3N4O2 |
| Molecular Weight | 547.38 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 1-[4-(4-acetylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]-9-bromo-2,4-dihydropyrazino[2,3-c]quinolin-3-one |
| SMILES | CC(=O)C1CCN(c2ccc(N3CC(=O)Nc4cnc5ccc(Br)cc5c43)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H22BrF3N4O2/c1-14(34)15-6-8-32(9-7-15)22-5-3-17(11-19(22)25(27,28)29)33-13-23(35)31-21-12-30-20-4-2-16(26)10-18(20)24(21)33/h2-5,10-12,15H,6-9,13H2,1H3,(H,31,35) |
| InChIKey | YXEKTYBTZUIYAY-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.38 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|