C35H36F3N7O2 — CID 58525040
N-(1-methylpiperidin-4-yl)-1-[4-[9-(1-methylpyrazol-4-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 58525040) has the molecular formula C35H36F3N7O2 and a molecular weight of 643.71 g/mol. Its IUPAC name is N-(1-methylpiperidin-4-yl)-1-[4-[9-(1-methylpyrazol-4-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | N-(1-methylpiperidin-4-yl)-1-[4-[9-(1-methylpyrazol-4-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58525040 |
| Molecular Formula | C35H36F3N7O2 |
| Molecular Weight | 643.71 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | N-(1-methylpiperidin-4-yl)-1-[4-[9-(1-methylpyrazol-4-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | CN1CCC(NC(=O)C2CCN(c3ccc(-n4c(=O)ccc5cnc6ccc(-c7cnn(C)c7)cc6c54)cc3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C35H36F3N7O2/c1-42-13-11-26(12-14-42)41-34(47)22-9-15-44(16-10-22)31-7-5-27(18-29(31)35(36,37)38)45-32(46)8-4-24-19-39-30-6-3-23(17-28(30)33(24)45)25-20-40-43(2)21-25/h3-8,17-22,26H,9-16H2,1-2H3,(H,41,47) |
| InChIKey | CPHKDXHCAWSMLU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|