About 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one
1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one (PubChem CID 58525059) has the molecular formula C24H20N4O
and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one.
Molecular Properties
| Compound Name | 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one |
| PubChem CID | 58525059 |
| Molecular Formula | C24H20N4O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one |
| SMILES | Cc1cn(-c2ccc3ncc4ccc(=O)n(-c5ccc(C)c(C)c5)c4c3c2)cn1 |
| InChI | InChI=1S/C24H20N4O/c1-15-4-6-20(10-16(15)2)28-23(29)9-5-18-12-25-22-8-7-19(11-21(22)24(18)28)27-13-17(3)26-14-27/h4-14H,1-3H3 |
| InChIKey | VJXANXKSIBKLCK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one?
The IUPAC name of 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one (CID 58525059) is 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one.
What is the SMILES notation for 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one?
The canonical SMILES for 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one is Cc1cn(-c2ccc3ncc4ccc(=O)n(-c5ccc(C)c(C)c5)c4c3c2)cn1.
What is the InChIKey of 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one?
The InChIKey is VJXANXKSIBKLCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N4O/c1-15-4-6-20(10-16(15)2)28-23(29)9-5-18-12-25-22-8-7-19(11-21(22)24(18)28)27-13-17(3)26-14-27/h4-14H,1-3H3.
What are the key properties of 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one?
1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one has a molecular weight of 380.45 g/mol, XLogP of 4.65, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylphenyl)-9-(4-methylimidazol-1-yl)benzo[h][1,6]naphthyridin-2-one is sourced from PubChem (CID 58525059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).