C31H23F3N4O2 — CID 58525103
1-[4-[2-(methylamino)ethoxy]-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one (PubChem CID 58525103) has the molecular formula C31H23F3N4O2 and a molecular weight of 540.55 g/mol. Its IUPAC name is 1-[4-[2-(methylamino)ethoxy]-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one.
| Compound Name | 1-[4-[2-(methylamino)ethoxy]-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 58525103 |
| Molecular Formula | C31H23F3N4O2 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 1-[4-[2-(methylamino)ethoxy]-3-(trifluoromethyl)phenyl]-9-quinolin-3-ylbenzo[h][1,6]naphthyridin-2-one |
| SMILES | CNCCOc1ccc(-n2c(=O)ccc3cnc4ccc(-c5cnc6ccccc6c5)cc4c32)cc1C(F)(F)F |
| InChI | InChI=1S/C31H23F3N4O2/c1-35-12-13-40-28-10-8-23(16-25(28)31(32,33)34)38-29(39)11-7-21-17-37-27-9-6-19(15-24(27)30(21)38)22-14-20-4-2-3-5-26(20)36-18-22/h2-11,14-18,35H,12-13H2,1H3 |
| InChIKey | WNDJAQWKYPISRS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|