C35H35F3N8O2 — CID 58525149
1-[4-[9-(2-aminopyrimidin-5-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)piperidine-4-carboxamide (PubChem CID 58525149) has the molecular formula C35H35F3N8O2 and a molecular weight of 656.71 g/mol. Its IUPAC name is 1-[4-[9-(2-aminopyrimidin-5-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-[4-[9-(2-aminopyrimidin-5-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58525149 |
| Molecular Formula | C35H35F3N8O2 |
| Molecular Weight | 656.71 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | 1-[4-[9-(2-aminopyrimidin-5-yl)-2-oxobenzo[h][1,6]naphthyridin-1-yl]-2-(trifluoromethyl)phenyl]-N-(1-methylpiperidin-4-yl)piperidine-4-carboxamide |
| SMILES | CN1CCC(NC(=O)C2CCN(c3ccc(-n4c(=O)ccc5cnc6ccc(-c7cnc(N)nc7)cc6c54)cc3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C35H35F3N8O2/c1-44-12-10-25(11-13-44)43-33(48)21-8-14-45(15-9-21)30-6-4-26(17-28(30)35(36,37)38)46-31(47)7-3-23-18-40-29-5-2-22(16-27(29)32(23)46)24-19-41-34(39)42-20-24/h2-7,16-21,25H,8-15H2,1H3,(H,43,48)(H2,39,41,42) |
| InChIKey | MXLUBLYSUALITE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.71 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|