C31H28F3N7O2 — CID 58525161
9-(2-aminopyrimidin-5-yl)-1-[4-(4-butanoylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 58525161) has the molecular formula C31H28F3N7O2 and a molecular weight of 587.61 g/mol. Its IUPAC name is 9-(2-aminopyrimidin-5-yl)-1-[4-(4-butanoylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-(2-aminopyrimidin-5-yl)-1-[4-(4-butanoylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 58525161 |
| Molecular Formula | C31H28F3N7O2 |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | 9-(2-aminopyrimidin-5-yl)-1-[4-(4-butanoylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | CCCC(=O)N1CCN(c2ccc(-n3c(=O)ccc4cnc5ccc(-c6cnc(N)nc6)cc5c43)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C31H28F3N7O2/c1-2-3-27(42)40-12-10-39(11-13-40)26-8-6-22(15-24(26)31(32,33)34)41-28(43)9-5-20-16-36-25-7-4-19(14-23(25)29(20)41)21-17-37-30(35)38-18-21/h4-9,14-18H,2-3,10-13H2,1H3,(H2,35,37,38) |
| InChIKey | LZALVYMGNOCQEY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|