About 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine
3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine (PubChem CID 58525285) has the molecular formula C14H20N4
and a molecular weight of 244.34 g/mol. Its IUPAC name is 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine |
| PubChem CID | 58525285 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine |
| SMILES | Cc1nccn2c(C)c(C[C@@H]3CCCCN3)nc12 |
| InChI | InChI=1S/C14H20N4/c1-10-14-17-13(9-12-5-3-4-6-16-12)11(2)18(14)8-7-15-10/h7-8,12,16H,3-6,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | DCNYOMCPZFKXGD-LBPRGKRZSA-N |
| XLogP | 2.03 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine?
The IUPAC name of 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine (CID 58525285) is 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine.
What is the SMILES notation for 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine?
The canonical SMILES for 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine is Cc1nccn2c(C)c(C[C@@H]3CCCCN3)nc12.
What is the InChIKey of 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine?
The InChIKey is DCNYOMCPZFKXGD-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H20N4/c1-10-14-17-13(9-12-5-3-4-6-16-12)11(2)18(14)8-7-15-10/h7-8,12,16H,3-6,9H2,1-2H3/t12-/m0/s1.
What are the key properties of 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine?
3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine has a molecular weight of 244.34 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethyl-2-[[(2S)-piperidin-2-yl]methyl]imidazo[1,2-a]pyrazine is sourced from PubChem (CID 58525285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).