About 5-ethyl-1,3-dimethyl-2,3-dihydroindole
5-ethyl-1,3-dimethyl-2,3-dihydroindole (PubChem CID 58525500) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 5-ethyl-1,3-dimethyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 5-ethyl-1,3-dimethyl-2,3-dihydroindole |
| PubChem CID | 58525500 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 5-ethyl-1,3-dimethyl-2,3-dihydroindole |
| SMILES | CCc1ccc2c(c1)C(C)CN2C |
| InChI | InChI=1S/C12H17N/c1-4-10-5-6-12-11(7-10)9(2)8-13(12)3/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | RATGUZGBDKXNBK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-1,3-dimethyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3-dimethyl-2,3-dihydroindole?
The IUPAC name of 5-ethyl-1,3-dimethyl-2,3-dihydroindole (CID 58525500) is 5-ethyl-1,3-dimethyl-2,3-dihydroindole.
What is the SMILES notation for 5-ethyl-1,3-dimethyl-2,3-dihydroindole?
The canonical SMILES for 5-ethyl-1,3-dimethyl-2,3-dihydroindole is CCc1ccc2c(c1)C(C)CN2C.
What is the InChIKey of 5-ethyl-1,3-dimethyl-2,3-dihydroindole?
The InChIKey is RATGUZGBDKXNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-4-10-5-6-12-11(7-10)9(2)8-13(12)3/h5-7,9H,4,8H2,1-3H3.
What are the key properties of 5-ethyl-1,3-dimethyl-2,3-dihydroindole?
5-ethyl-1,3-dimethyl-2,3-dihydroindole has a molecular weight of 175.27 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3-dimethyl-2,3-dihydroindole is sourced from PubChem (CID 58525500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).