C22H22N4O3 — CID 58525613
N-[4-[3-(2-hydroxyacetyl)quinolin-6-yl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 58525613) has the molecular formula C22H22N4O3 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-[4-[3-(2-hydroxyacetyl)quinolin-6-yl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | N-[4-[3-(2-hydroxyacetyl)quinolin-6-yl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58525613 |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-[4-[3-(2-hydroxyacetyl)quinolin-6-yl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | O=C(CO)c1cnc2ccc(-c3ccnc(NC(=O)C4CCNCC4)c3)cc2c1 |
| InChI | InChI=1S/C22H22N4O3/c27-13-20(28)18-10-17-9-15(1-2-19(17)25-12-18)16-5-8-24-21(11-16)26-22(29)14-3-6-23-7-4-14/h1-2,5,8-12,14,23,27H,3-4,6-7,13H2,(H,24,26,29) |
| InChIKey | XANLPSSWWKUJJF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |