About 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one
4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one (PubChem CID 58526153) has the molecular formula C9H10OS
and a molecular weight of 166.25 g/mol. Its IUPAC name is 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one.
Molecular Properties
| Compound Name | 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one |
| PubChem CID | 58526153 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one |
| SMILES | CC1C(=O)c2sccc2C1C |
| InChI | InChI=1S/C9H10OS/c1-5-6(2)8(10)9-7(5)3-4-11-9/h3-6H,1-2H3 |
| InChIKey | KWGXHAKFXRZDCB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one?
The IUPAC name of 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one (CID 58526153) is 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one.
What is the SMILES notation for 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one?
The canonical SMILES for 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one is CC1C(=O)c2sccc2C1C.
What is the InChIKey of 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one?
The InChIKey is KWGXHAKFXRZDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS/c1-5-6(2)8(10)9-7(5)3-4-11-9/h3-6H,1-2H3.
What are the key properties of 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one?
4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one has a molecular weight of 166.25 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-4,5-dihydrocyclopenta[b]thiophen-6-one is sourced from PubChem (CID 58526153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).