C26H45N3O4 — CID 58526179
[1-(N-acetyl-N,N'-dicyclohexylcarbamimidoyl)oxy-2,2,6,6-tetramethylpiperidin-4-yl] acetate (PubChem CID 58526179) has the molecular formula C26H45N3O4 and a molecular weight of 463.66 g/mol. Its IUPAC name is [1-(N-acetyl-N,N'-dicyclohexylcarbamimidoyl)oxy-2,2,6,6-tetramethylpiperidin-4-yl] acetate.
| Compound Name | [1-(N-acetyl-N,N'-dicyclohexylcarbamimidoyl)oxy-2,2,6,6-tetramethylpiperidin-4-yl] acetate |
|---|---|
| PubChem CID | 58526179 |
| Molecular Formula | C26H45N3O4 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.34 |
| IUPAC Name | [1-(N-acetyl-N,N'-dicyclohexylcarbamimidoyl)oxy-2,2,6,6-tetramethylpiperidin-4-yl] acetate |
| SMILES | CC(=O)OC1CC(C)(C)N(O/C(=N/C2CCCCC2)N(C(C)=O)C2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C26H45N3O4/c1-19(30)28(22-15-11-8-12-16-22)24(27-21-13-9-7-10-14-21)33-29-25(3,4)17-23(32-20(2)31)18-26(29,5)6/h21-23H,7-18H2,1-6H3/b27-24+ |
| InChIKey | KBCKANBSGDULKW-SOYKGTTHSA-N |
| XLogP | 5.37 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|