C9H16O2 — CID 58526212
(3aR,6aR)-3,6,6a-trimethyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan (PubChem CID 58526212) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (3aR,6aR)-3,6,6a-trimethyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan.
| Compound Name | (3aR,6aR)-3,6,6a-trimethyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan |
|---|---|
| PubChem CID | 58526212 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (3aR,6aR)-3,6,6a-trimethyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan |
| SMILES | CC1CO[C@]2(C)C(C)CO[C@H]12 |
| InChI | InChI=1S/C9H16O2/c1-6-4-11-9(3)7(2)5-10-8(6)9/h6-8H,4-5H2,1-3H3/t6?,7?,8-,9-/m1/s1 |
| InChIKey | NDYDALWCPBBACT-GEPGNKONSA-N |
| XLogP | 1.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |