C59H39N5 — CID 58526504
2-naphthalen-2-yl-4,6-bis[3-phenyl-5-(4-pyridin-2-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 58526504) has the molecular formula C59H39N5 and a molecular weight of 818.00 g/mol. Its IUPAC name is 2-naphthalen-2-yl-4,6-bis[3-phenyl-5-(4-pyridin-2-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-naphthalen-2-yl-4,6-bis[3-phenyl-5-(4-pyridin-2-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58526504 |
| Molecular Formula | C59H39N5 |
| Molecular Weight | 818.00 g/mol |
| Exact Mass | 817.32 |
| IUPAC Name | 2-naphthalen-2-yl-4,6-bis[3-phenyl-5-(4-pyridin-2-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccccn4)cc3)cc(-c3nc(-c4cc(-c5ccccc5)cc(-c5ccc(-c6ccccn6)cc5)c4)nc(-c4ccc5ccccc5c4)n3)c2)cc1 |
| InChI | InChI=1S/C59H39N5/c1-3-13-40(14-4-1)49-34-51(43-21-26-45(27-22-43)55-19-9-11-31-60-55)38-53(36-49)58-62-57(48-30-25-42-17-7-8-18-47(42)33-48)63-59(64-58)54-37-50(41-15-5-2-6-16-41)35-52(39-54)44-23-28-46(29-24-44)56-20-10-12-32-61-56/h1-39H |
| InChIKey | ASUBYICFJYRELD-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.00 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |