C45H29Cl2N3 — CID 58526510
2,4-bis[3-chloro-5-(4-phenylphenyl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 58526510) has the molecular formula C45H29Cl2N3 and a molecular weight of 682.65 g/mol. Its IUPAC name is 2,4-bis[3-chloro-5-(4-phenylphenyl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2,4-bis[3-chloro-5-(4-phenylphenyl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58526510 |
| Molecular Formula | C45H29Cl2N3 |
| Molecular Weight | 682.65 g/mol |
| Exact Mass | 681.17 |
| IUPAC Name | 2,4-bis[3-chloro-5-(4-phenylphenyl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | Clc1cc(-c2ccc(-c3ccccc3)cc2)cc(-c2nc(-c3ccccc3)nc(-c3cc(Cl)cc(-c4ccc(-c5ccccc5)cc4)c3)n2)c1 |
| InChI | InChI=1S/C45H29Cl2N3/c46-41-26-37(34-20-16-32(17-21-34)30-10-4-1-5-11-30)24-39(28-41)44-48-43(36-14-8-3-9-15-36)49-45(50-44)40-25-38(27-42(47)29-40)35-22-18-33(19-23-35)31-12-6-2-7-13-31/h1-29H |
| InChIKey | IYNVYIPEKQNSQC-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.65 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |