C33H19Br2Cl2N3 — CID 58526512
2,4-bis(3-chloro-5-phenylphenyl)-6-(3,5-dibromophenyl)-1,3,5-triazine (PubChem CID 58526512) has the molecular formula C33H19Br2Cl2N3 and a molecular weight of 688.25 g/mol. Its IUPAC name is 2,4-bis(3-chloro-5-phenylphenyl)-6-(3,5-dibromophenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis(3-chloro-5-phenylphenyl)-6-(3,5-dibromophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58526512 |
| Molecular Formula | C33H19Br2Cl2N3 |
| Molecular Weight | 688.25 g/mol |
| Exact Mass | 684.93 |
| IUPAC Name | 2,4-bis(3-chloro-5-phenylphenyl)-6-(3,5-dibromophenyl)-1,3,5-triazine |
| SMILES | Clc1cc(-c2ccccc2)cc(-c2nc(-c3cc(Br)cc(Br)c3)nc(-c3cc(Cl)cc(-c4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C33H19Br2Cl2N3/c34-27-13-26(14-28(35)19-27)33-39-31(24-11-22(15-29(36)17-24)20-7-3-1-4-8-20)38-32(40-33)25-12-23(16-30(37)18-25)21-9-5-2-6-10-21/h1-19H |
| InChIKey | XLYQIWOBXWVZHO-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.25 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |