C21H22N5O7P — CID 58527331
(2R,3R,4S,5R)-3,4-dihydroxy-2-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(2R,4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-2-carbonitrile (PubChem CID 58527331) has the molecular formula C21H22N5O7P and a molecular weight of 487.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4-dihydroxy-2-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(2R,4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-2-carbonitrile.
| Compound Name | (2R,3R,4S,5R)-3,4-dihydroxy-2-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(2R,4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 58527331 |
| Molecular Formula | C21H22N5O7P |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | (2R,3R,4S,5R)-3,4-dihydroxy-2-(4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-[[(2R,4S)-2-oxo-4-pyridin-4-yl-1,3,2λ5-dioxaphosphinan-2-yl]oxymethyl]oxolane-2-carbonitrile |
| SMILES | Cc1ncnn2c([C@]3(C#N)O[C@H](CO[P@@]4(=O)OCC[C@@H](c5ccncc5)O4)[C@@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C21H22N5O7P/c1-13-15-2-3-18(26(15)25-12-24-13)21(11-22)20(28)19(27)17(32-21)10-31-34(29)30-9-6-16(33-34)14-4-7-23-8-5-14/h2-5,7-8,12,16-17,19-20,27-28H,6,9-10H2,1H3/t16-,17+,19+,20+,21-,34+/m0/s1 |
| InChIKey | WZMPNPBIEDHXAR-JVTSHVFUSA-N |
| XLogP | 1.58 |
| TPSA | 161.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|