C9H10F6NNaO4S — CID 58527730
sodium 1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)piperidine-4-carboxylic acid (PubChem CID 58527730) has the molecular formula C9H10F6NNaO4S and a molecular weight of 365.23 g/mol. Its IUPAC name is sodium 1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)piperidine-4-carboxylic acid.
| Compound Name | sodium 1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58527730 |
| Molecular Formula | C9H10F6NNaO4S |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | sodium 1-(1,1,2,2,3,3-hexafluoropropylsulfonyl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)C(F)(F)C(F)(F)[C-](F)F)CC1.[Na+] |
| InChI | InChI=1S/C9H10F6NO4S.Na/c10-7(11)8(12,13)9(14,15)21(19,20)16-3-1-5(2-4-16)6(17)18;/h5H,1-4H2,(H,17,18);/q-1;+1 |
| InChIKey | QJBCSQKVNKHFLE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|