C22H40O2 — CID 58527740
(8a-ethyl-1,4,4,6-tetramethyl-2,3,3a,5,7,8-hexahydro-1H-azulen-6-yl) 2,2-dimethylbutanoate (PubChem CID 58527740) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is (8a-ethyl-1,4,4,6-tetramethyl-2,3,3a,5,7,8-hexahydro-1H-azulen-6-yl) 2,2-dimethylbutanoate.
| Compound Name | (8a-ethyl-1,4,4,6-tetramethyl-2,3,3a,5,7,8-hexahydro-1H-azulen-6-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58527740 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | (8a-ethyl-1,4,4,6-tetramethyl-2,3,3a,5,7,8-hexahydro-1H-azulen-6-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CCC2(CC)C(C)CCC2C(C)(C)C1 |
| InChI | InChI=1S/C22H40O2/c1-9-19(4,5)18(23)24-21(8)13-14-22(10-2)16(3)11-12-17(22)20(6,7)15-21/h16-17H,9-15H2,1-8H3 |
| InChIKey | XEUUHSNXVSJOFP-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |