C18H26NO3P — CID 58528110
(1R,3R,3aS)-1-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxy-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole (PubChem CID 58528110) has the molecular formula C18H26NO3P and a molecular weight of 335.38 g/mol. Its IUPAC name is (1R,3R,3aS)-1-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxy-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole.
| Compound Name | (1R,3R,3aS)-1-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxy-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole |
|---|---|
| PubChem CID | 58528110 |
| Molecular Formula | C18H26NO3P |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (1R,3R,3aS)-1-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxy-3-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]oxazaphosphole |
| SMILES | CC[C@H]1O[C@@H](C)CC1O[P@@]1O[C@H](c2ccccc2)[C@@H]2CCCN21 |
| InChI | InChI=1S/C18H26NO3P/c1-3-16-17(12-13(2)20-16)21-23-19-11-7-10-15(19)18(22-23)14-8-5-4-6-9-14/h4-6,8-9,13,15-18H,3,7,10-12H2,1-2H3/t13-,15-,16+,17?,18+,23-/m0/s1 |
| InChIKey | WRLGEMGJBMOJFH-CMMPGQSDSA-N |
| XLogP | 4.42 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|