C19H28NO3P — CID 58528114
(1S,3R,3aS)-1-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxy-3-methyl-3-phenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphole (PubChem CID 58528114) has the molecular formula C19H28NO3P and a molecular weight of 349.41 g/mol. Its IUPAC name is (1S,3R,3aS)-1-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxy-3-methyl-3-phenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphole.
| Compound Name | (1S,3R,3aS)-1-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxy-3-methyl-3-phenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphole |
|---|---|
| PubChem CID | 58528114 |
| Molecular Formula | C19H28NO3P |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (1S,3R,3aS)-1-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxy-3-methyl-3-phenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphole |
| SMILES | CC[C@H]1O[C@@H](C)CC1O[P@@]1O[C@](C)(c2ccccc2)[C@@H]2CCCN21 |
| InChI | InChI=1S/C19H28NO3P/c1-4-16-17(13-14(2)21-16)22-24-20-12-8-11-18(20)19(3,23-24)15-9-6-5-7-10-15/h5-7,9-10,14,16-18H,4,8,11-13H2,1-3H3/t14-,16+,17?,18-,19+,24-/m0/s1 |
| InChIKey | BKMXLWZXGFCJAT-NURBNEIVSA-N |
| XLogP | 4.60 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|