C34H34F3N5O2 — CID 58528706
(4S)-1'-benzyl-4'-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine-9,3'-pyrrolidine] (PubChem CID 58528706) has the molecular formula C34H34F3N5O2 and a molecular weight of 601.67 g/mol. Its IUPAC name is (4S)-1'-benzyl-4'-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine-9,3'-pyrrolidine].
| Compound Name | (4S)-1'-benzyl-4'-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine-9,3'-pyrrolidine] |
|---|---|
| PubChem CID | 58528706 |
| Molecular Formula | C34H34F3N5O2 |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | (4S)-1'-benzyl-4'-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-4-(3,4,5-trifluorophenyl)spiro[4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine-9,3'-pyrrolidine] |
| SMILES | COc1cc(C2CN(Cc3ccccc3)CC23CCCN2C3=NOC[C@@H]2c2cc(F)c(F)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C34H34F3N5O2/c1-22-16-41(21-38-22)29-10-9-24(15-31(29)43-2)26-18-40(17-23-7-4-3-5-8-23)20-34(26)11-6-12-42-30(19-44-39-33(34)42)25-13-27(35)32(37)28(36)14-25/h3-5,7-10,13-16,21,26,30H,6,11-12,17-20H2,1-2H3/t26?,30-,34?/m1/s1 |
| InChIKey | XBNBWQZMORHEQP-PQVCLWJQSA-N |
| XLogP | 6.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|