C25H24ClFN4O2 — CID 58528732
(4S,9E)-4-(3-chloro-5-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 58528732) has the molecular formula C25H24ClFN4O2 and a molecular weight of 466.94 g/mol. Its IUPAC name is (4S,9E)-4-(3-chloro-5-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | (4S,9E)-4-(3-chloro-5-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 58528732 |
| Molecular Formula | C25H24ClFN4O2 |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (4S,9E)-4-(3-chloro-5-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4,6,7,8-tetrahydro-3H-pyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | COc1cc(/C=C2\CCCN3C2=NOC[C@@H]3c2cc(F)cc(Cl)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H24ClFN4O2/c1-16-13-30(15-28-16)22-6-5-17(9-24(22)32-2)8-18-4-3-7-31-23(14-33-29-25(18)31)19-10-20(26)12-21(27)11-19/h5-6,8-13,15,23H,3-4,7,14H2,1-2H3/b18-8+/t23-/m1/s1 |
| InChIKey | ZOEPMNJUXPITLU-HDOHGRBBSA-N |
| XLogP | 5.55 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |