C23H26N3O7PS — CID 58528815
[5-[[3-(4-ethylsulfonylphenoxy)-5-propan-2-yloxybenzoyl]amino]pyrazin-2-yl]-methylphosphinic acid (PubChem CID 58528815) has the molecular formula C23H26N3O7PS and a molecular weight of 519.52 g/mol. Its IUPAC name is [5-[[3-(4-ethylsulfonylphenoxy)-5-propan-2-yloxybenzoyl]amino]pyrazin-2-yl]-methylphosphinic acid.
| Compound Name | [5-[[3-(4-ethylsulfonylphenoxy)-5-propan-2-yloxybenzoyl]amino]pyrazin-2-yl]-methylphosphinic acid |
|---|---|
| PubChem CID | 58528815 |
| Molecular Formula | C23H26N3O7PS |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | [5-[[3-(4-ethylsulfonylphenoxy)-5-propan-2-yloxybenzoyl]amino]pyrazin-2-yl]-methylphosphinic acid |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc(OC(C)C)cc(C(=O)Nc3cnc(P(C)(=O)O)cn3)c2)cc1 |
| InChI | InChI=1S/C23H26N3O7PS/c1-5-35(30,31)20-8-6-17(7-9-20)33-19-11-16(10-18(12-19)32-15(2)3)23(27)26-21-13-25-22(14-24-21)34(4,28)29/h6-15H,5H2,1-4H3,(H,28,29)(H,24,26,27) |
| InChIKey | ZVHNRZPVOIKBCW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 144.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|