About 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol
2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 58529131) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol.
Molecular Properties
| Compound Name | 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol |
| PubChem CID | 58529131 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | CC1=CC(O)C(O)C(C(C)(C)C)O1 |
| InChI | InChI=1S/C10H18O3/c1-6-5-7(11)8(12)9(13-6)10(2,3)4/h5,7-9,11-12H,1-4H3 |
| InChIKey | MIKKGJUTQJGLHY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol?
The IUPAC name of 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol (CID 58529131) is 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol.
What is the SMILES notation for 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol?
The canonical SMILES for 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol is CC1=CC(O)C(O)C(C(C)(C)C)O1.
What is the InChIKey of 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol?
The InChIKey is MIKKGJUTQJGLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-6-5-7(11)8(12)9(13-6)10(2,3)4/h5,7-9,11-12H,1-4H3.
What are the key properties of 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol?
2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol has a molecular weight of 186.25 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-methyl-3,4-dihydro-2H-pyran-3,4-diol is sourced from PubChem (CID 58529131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).