C33H32N8O — CID 58529556
7-(8-benzyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl)-5-(2-phenylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58529556) has the molecular formula C33H32N8O and a molecular weight of 556.67 g/mol. Its IUPAC name is 7-(8-benzyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl)-5-(2-phenylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-(8-benzyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl)-5-(2-phenylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58529556 |
| Molecular Formula | C33H32N8O |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 7-(8-benzyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl)-5-(2-phenylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(C3CN4CCN(Cc5ccccc5)CC4CO3)cc(-c3ccc4cn(-c5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C33H32N8O/c34-33-32-28(24-11-12-25-18-40(37-29(25)15-24)26-9-5-2-6-10-26)16-30(41(32)36-22-35-33)31-20-39-14-13-38(19-27(39)21-42-31)17-23-7-3-1-4-8-23/h1-12,15-16,18,22,27,31H,13-14,17,19-21H2,(H2,34,35,36) |
| InChIKey | WQCKDHLOFFIQHU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |