C32H34N10 — CID 58529619
5-(2-benzylindazol-6-yl)-7-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58529619) has the molecular formula C32H34N10 and a molecular weight of 558.69 g/mol. Its IUPAC name is 5-(2-benzylindazol-6-yl)-7-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(2-benzylindazol-6-yl)-7-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58529619 |
| Molecular Formula | C32H34N10 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 5-(2-benzylindazol-6-yl)-7-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(CCCCN3CCN(c4ncccn4)CC3)cc(-c3ccc4cn(Cc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C32H34N10/c33-31-30-28(25-10-11-26-22-41(38-29(26)19-25)21-24-7-2-1-3-8-24)20-27(42(30)37-23-36-31)9-4-5-14-39-15-17-40(18-16-39)32-34-12-6-13-35-32/h1-3,6-8,10-13,19-20,22-23H,4-5,9,14-18,21H2,(H2,33,36,37) |
| InChIKey | NGVDYGIHHXBCLL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|