C32H37N7O2 — CID 58529753
ethyl 1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidine-2-carboxylate (PubChem CID 58529753) has the molecular formula C32H37N7O2 and a molecular weight of 551.70 g/mol. Its IUPAC name is ethyl 1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 58529753 |
| Molecular Formula | C32H37N7O2 |
| Molecular Weight | 551.70 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | ethyl 1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1CCCCc1cc(-c2ccc3cn(Cc4ccccc4)nc3c2)c2c(N)ncnn12 |
| InChI | InChI=1S/C32H37N7O2/c1-2-41-32(40)29-13-7-9-17-37(29)16-8-6-12-26-19-27(30-31(33)34-22-35-39(26)30)24-14-15-25-21-38(36-28(25)18-24)20-23-10-4-3-5-11-23/h3-5,10-11,14-15,18-19,21-22,29H,2,6-9,12-13,16-17,20H2,1H3,(H2,33,34,35) |
| InChIKey | LGOCDQZZCFERMG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|