C28H30N8O3S — CID 58529791
5-(2-benzylindazol-6-yl)-7-(8-methylsulfonyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58529791) has the molecular formula C28H30N8O3S and a molecular weight of 558.67 g/mol. Its IUPAC name is 5-(2-benzylindazol-6-yl)-7-(8-methylsulfonyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(2-benzylindazol-6-yl)-7-(8-methylsulfonyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58529791 |
| Molecular Formula | C28H30N8O3S |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | 5-(2-benzylindazol-6-yl)-7-(8-methylsulfonyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-3-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CS(=O)(=O)N1CCN2CC(c3cc(-c4ccc5cn(Cc6ccccc6)nc5c4)c4c(N)ncnn34)OCC2C1 |
| InChI | InChI=1S/C28H30N8O3S/c1-40(37,38)35-10-9-33-16-26(39-17-22(33)15-35)25-12-23(27-28(29)30-18-31-36(25)27)20-7-8-21-14-34(32-24(21)11-20)13-19-5-3-2-4-6-19/h2-8,11-12,14,18,22,26H,9-10,13,15-17H2,1H3,(H2,29,30,31) |
| InChIKey | CQCRLBLYBPGQMA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 123.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |