C7H4BrN5 — CID 58529898
7-bromo-6-isocyanopyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58529898) has the molecular formula C7H4BrN5 and a molecular weight of 238.05 g/mol. Its IUPAC name is 7-bromo-6-isocyanopyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-bromo-6-isocyanopyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58529898 |
| Molecular Formula | C7H4BrN5 |
| Molecular Weight | 238.05 g/mol |
| Exact Mass | 236.97 |
| IUPAC Name | 7-bromo-6-isocyanopyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | [C-]#[N+]c1cc2c(N)ncnn2c1Br |
| InChI | InChI=1S/C7H4BrN5/c1-10-4-2-5-7(9)11-3-12-13(5)6(4)8/h2-3H,(H2,9,11,12) |
| InChIKey | KONDWKWHRVHFDM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 60.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.05 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|