About tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane
tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane (PubChem CID 58530192) has the molecular formula C14H24OSi
and a molecular weight of 236.43 g/mol. Its IUPAC name is tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane |
| PubChem CID | 58530192 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane |
| SMILES | Cc1cccc(O[Si](C)(C)C(C)(C)C)c1C |
| InChI | InChI=1S/C14H24OSi/c1-11-9-8-10-13(12(11)2)15-16(6,7)14(3,4)5/h8-10H,1-7H3 |
| InChIKey | HNFBPICGQRTYTN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane?
The IUPAC name of tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane (CID 58530192) is tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane.
What is the SMILES notation for tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane?
The canonical SMILES for tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane is Cc1cccc(O[Si](C)(C)C(C)(C)C)c1C.
What is the InChIKey of tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane?
The InChIKey is HNFBPICGQRTYTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24OSi/c1-11-9-8-10-13(12(11)2)15-16(6,7)14(3,4)5/h8-10H,1-7H3.
What are the key properties of tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane?
tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane has a molecular weight of 236.43 g/mol, XLogP of 4.69, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(2,3-dimethylphenoxy)-dimethylsilane is sourced from PubChem (CID 58530192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).