C19H23BrNO6S+ — CID 58530230
methyl (1R)-1-[2-[(2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidin-1-ium-2-yl]-2-oxoethyl]-2-ethenylcyclopropane-1-carboxylate (PubChem CID 58530230) has the molecular formula C19H23BrNO6S+ and a molecular weight of 473.37 g/mol. Its IUPAC name is methyl (1R)-1-[2-[(2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidin-1-ium-2-yl]-2-oxoethyl]-2-ethenylcyclopropane-1-carboxylate.
| Compound Name | methyl (1R)-1-[2-[(2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidin-1-ium-2-yl]-2-oxoethyl]-2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 58530230 |
| Molecular Formula | C19H23BrNO6S+ |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | methyl (1R)-1-[2-[(2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidin-1-ium-2-yl]-2-oxoethyl]-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=CC1C[C@]1(CC(=O)[C@@H]1C[C@H](OS(=O)(=O)c2ccc(Br)cc2)C[NH2+]1)C(=O)OC |
| InChI | InChI=1S/C19H22BrNO6S/c1-3-12-9-19(12,18(23)26-2)10-17(22)16-8-14(11-21-16)27-28(24,25)15-6-4-13(20)5-7-15/h3-7,12,14,16,21H,1,8-11H2,2H3/p+1/t12?,14-,16-,19+/m0/s1 |
| InChIKey | NMKVJFXJAKPFRN-FISHJPCKSA-O |
| XLogP | 1.18 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|