C26H22F6N4O2S — CID 58530407
(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 58530407) has the molecular formula C26H22F6N4O2S and a molecular weight of 568.54 g/mol. Its IUPAC name is (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58530407 |
| Molecular Formula | C26H22F6N4O2S |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(2-pyrrolidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc3c(cnn3Cc3ccc(C(F)(F)F)cc3C(F)(F)F)c2)C(=O)N1CCN1CCCC1 |
| InChI | InChI=1S/C26H22F6N4O2S/c27-25(28,29)19-5-4-17(20(13-19)26(30,31)32)15-36-21-6-3-16(11-18(21)14-33-36)12-22-23(37)35(24(38)39-22)10-9-34-7-1-2-8-34/h3-6,11-14H,1-2,7-10,15H2/b22-12- |
| InChIKey | DOVWGXRBVVYXRN-UUYOSTAYSA-N |
| XLogP | 6.25 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|