C21H15ClF3N5O5S2 — CID 58530416
2-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-sulfamoylacetamide (PubChem CID 58530416) has the molecular formula C21H15ClF3N5O5S2 and a molecular weight of 573.96 g/mol. Its IUPAC name is 2-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-sulfamoylacetamide.
| Compound Name | 2-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-sulfamoylacetamide |
|---|---|
| PubChem CID | 58530416 |
| Molecular Formula | C21H15ClF3N5O5S2 |
| Molecular Weight | 573.96 g/mol |
| Exact Mass | 573.02 |
| IUPAC Name | 2-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-sulfamoylacetamide |
| SMILES | NS(=O)(=O)NC(=O)CN1C(=O)S/C(=C\c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C21H15ClF3N5O5S2/c22-14-3-2-12(15(7-14)21(23,24)25)9-30-16-4-1-11(5-13(16)8-27-30)6-17-19(32)29(20(33)36-17)10-18(31)28-37(26,34)35/h1-8H,9-10H2,(H,28,31)(H2,26,34,35)/b17-6- |
| InChIKey | SELUGOLSBVLXAV-FMQZQXMHSA-N |
| XLogP | 3.11 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.96 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|