C25H21ClF3N3O3S — CID 58530437
(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[[(3S)-oxan-3-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 58530437) has the molecular formula C25H21ClF3N3O3S and a molecular weight of 535.98 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[[(3S)-oxan-3-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[[(3S)-oxan-3-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58530437 |
| Molecular Formula | C25H21ClF3N3O3S |
| Molecular Weight | 535.98 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-[[(3S)-oxan-3-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C(=O)N1C[C@@H]1CCCOC1 |
| InChI | InChI=1S/C25H21ClF3N3O3S/c26-19-5-4-17(20(10-19)25(27,28)29)13-32-21-6-3-15(8-18(21)11-30-32)9-22-23(33)31(24(34)36-22)12-16-2-1-7-35-14-16/h3-6,8-11,16H,1-2,7,12-14H2/b22-9-/t16-/m0/s1 |
| InChIKey | KNVPCGMTPMPKEB-RDPJMFKYSA-N |
| XLogP | 6.22 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.98 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|