C21H13ClF3N7O2S — CID 58530485
(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(2H-tetrazol-5-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 58530485) has the molecular formula C21H13ClF3N7O2S and a molecular weight of 519.90 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(2H-tetrazol-5-ylmethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(2H-tetrazol-5-ylmethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58530485 |
| Molecular Formula | C21H13ClF3N7O2S |
| Molecular Weight | 519.90 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | (5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-3-(2H-tetrazol-5-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C(=O)N1Cc1nn[nH]n1 |
| InChI | InChI=1S/C21H13ClF3N7O2S/c22-14-3-2-12(15(7-14)21(23,24)25)9-32-16-4-1-11(5-13(16)8-26-32)6-17-19(33)31(20(34)35-17)10-18-27-29-30-28-18/h1-8H,9-10H2,(H,27,28,29,30)/b17-6- |
| InChIKey | CVVQPJUXZSJHRQ-FMQZQXMHSA-N |
| XLogP | 4.51 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.90 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|