C23H15ClF3N3O4S — CID 58530486
(E)-4-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]but-2-enoic acid (PubChem CID 58530486) has the molecular formula C23H15ClF3N3O4S and a molecular weight of 521.90 g/mol. Its IUPAC name is (E)-4-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]but-2-enoic acid.
| Compound Name | (E)-4-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 58530486 |
| Molecular Formula | C23H15ClF3N3O4S |
| Molecular Weight | 521.90 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | (E)-4-[(5Z)-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]but-2-enoic acid |
| SMILES | O=C(O)/C=C/CN1C(=O)S/C(=C\c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C23H15ClF3N3O4S/c24-16-5-4-14(17(10-16)23(25,26)27)12-30-18-6-3-13(8-15(18)11-28-30)9-19-21(33)29(22(34)35-19)7-1-2-20(31)32/h1-6,8-11H,7,12H2,(H,31,32)/b2-1+,19-9- |
| InChIKey | HFMZJMFRPPKIGK-LCUBDLGASA-N |
| XLogP | 5.43 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|