C22H18ClF3N4O2S — CID 58530717
(5Z)-3-[(2S)-2-aminopropyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58530717) has the molecular formula C22H18ClF3N4O2S and a molecular weight of 494.93 g/mol. Its IUPAC name is (5Z)-3-[(2S)-2-aminopropyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(2S)-2-aminopropyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58530717 |
| Molecular Formula | C22H18ClF3N4O2S |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (5Z)-3-[(2S)-2-aminopropyl]-5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | C[C@H](N)CN1C(=O)S/C(=C\c2ccc3c(cnn3Cc3ccc(Cl)cc3C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C22H18ClF3N4O2S/c1-12(27)10-29-20(31)19(33-21(29)32)7-13-2-5-18-15(6-13)9-28-30(18)11-14-3-4-16(23)8-17(14)22(24,25)26/h2-9,12H,10-11,27H2,1H3/b19-7-/t12-/m0/s1 |
| InChIKey | WLCZSCXOKRATKN-IMMGQNJASA-N |
| XLogP | 5.14 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|