C8H14S — CID 58531331
(3S)-2,3,4,5-tetramethyl-2,3-dihydrothiophene (PubChem CID 58531331) has the molecular formula C8H14S and a molecular weight of 142.27 g/mol. Its IUPAC name is (3S)-2,3,4,5-tetramethyl-2,3-dihydrothiophene.
| Compound Name | (3S)-2,3,4,5-tetramethyl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 58531331 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | (3S)-2,3,4,5-tetramethyl-2,3-dihydrothiophene |
| SMILES | CC1=C(C)[C@H](C)C(C)S1 |
| InChI | InChI=1S/C8H14S/c1-5-6(2)8(4)9-7(5)3/h5,7H,1-4H3/t5-,7?/m0/s1 |
| InChIKey | HWTJCHZWSDWGLP-DSEUIKHZSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |