C22H26F6N2O2 — CID 585318
N-[2-(1-adamantylmethylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methoxybenzamide (PubChem CID 585318) has the molecular formula C22H26F6N2O2 and a molecular weight of 464.45 g/mol. Its IUPAC name is N-[2-(1-adamantylmethylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methoxybenzamide.
| Compound Name | N-[2-(1-adamantylmethylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 585318 |
| Molecular Formula | C22H26F6N2O2 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-[2-(1-adamantylmethylamino)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(NCC12CC3CC(CC(C3)C1)C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C22H26F6N2O2/c1-32-17-5-3-2-4-16(17)18(31)30-20(21(23,24)25,22(26,27)28)29-12-19-9-13-6-14(10-19)8-15(7-13)11-19/h2-5,13-15,29H,6-12H2,1H3,(H,30,31) |
| InChIKey | RAIODQPSFNKDPK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|