C12H13ClFN7O — CID 58531842
(1R,2S,3R,4S,6S)-6-azido-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 58531842) has the molecular formula C12H13ClFN7O and a molecular weight of 325.74 g/mol. Its IUPAC name is (1R,2S,3R,4S,6S)-6-azido-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,3R,4S,6S)-6-azido-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 58531842 |
| Molecular Formula | C12H13ClFN7O |
| Molecular Weight | 325.74 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (1R,2S,3R,4S,6S)-6-azido-3-[(2-chloro-5-fluoropyrimidin-4-yl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | [N-]=[N+]=N[C@H]1C[C@@H]2C[C@@H]1[C@H](C(N)=O)[C@@H]2Nc1nc(Cl)ncc1F |
| InChI | InChI=1S/C12H13ClFN7O/c13-12-17-3-6(14)11(19-12)18-9-4-1-5(8(9)10(15)22)7(2-4)20-21-16/h3-5,7-9H,1-2H2,(H2,15,22)(H,17,18,19)/t4-,5-,7-,8-,9+/m0/s1 |
| InChIKey | ULUPCXSCGBWABX-XADYHYHXSA-N |
| XLogP | 1.87 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.74 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|