C13H13ClFN3O — CID 58531924
(1R,2S,3R,4S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 58531924) has the molecular formula C13H13ClFN3O and a molecular weight of 281.72 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,3R,4S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 58531924 |
| Molecular Formula | C13H13ClFN3O |
| Molecular Weight | 281.72 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (1R,2S,3R,4S)-3-[(2-chloro-5-fluoropyrimidin-4-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | NC(=O)[C@@H]1[C@H](Cc2nc(Cl)ncc2F)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C13H13ClFN3O/c14-13-17-5-9(15)10(18-13)4-8-6-1-2-7(3-6)11(8)12(16)19/h1-2,5-8,11H,3-4H2,(H2,16,19)/t6-,7+,8-,11+/m1/s1 |
| InChIKey | RLWUWWZSFIETAF-UVMAFCGOSA-N |
| XLogP | 1.74 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.72 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|