C22H25FN2O2 — CID 58531940
(16E)-6-fluoro-14,19-dioxa-4,26-diazatetracyclo[18.3.1.13,7.19,13]hexacosa-1(24),3,5,7(26),16,20,22-heptaene (PubChem CID 58531940) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is (16E)-6-fluoro-14,19-dioxa-4,26-diazatetracyclo[18.3.1.13,7.19,13]hexacosa-1(24),3,5,7(26),16,20,22-heptaene.
| Compound Name | (16E)-6-fluoro-14,19-dioxa-4,26-diazatetracyclo[18.3.1.13,7.19,13]hexacosa-1(24),3,5,7(26),16,20,22-heptaene |
|---|---|
| PubChem CID | 58531940 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (16E)-6-fluoro-14,19-dioxa-4,26-diazatetracyclo[18.3.1.13,7.19,13]hexacosa-1(24),3,5,7(26),16,20,22-heptaene |
| SMILES | Fc1cnc2nc1CC1CCCC(C1)OC/C=C/COc1cccc(c1)C2 |
| InChI | InChI=1S/C22H25FN2O2/c23-20-15-24-22-14-17-6-4-8-19(12-17)27-10-2-1-9-26-18-7-3-5-16(11-18)13-21(20)25-22/h1-2,4,6,8,12,15-16,18H,3,5,7,9-11,13-14H2/b2-1+ |
| InChIKey | LHFWRLJRVIORCZ-OWOJBTEDSA-N |
| XLogP | 4.27 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|