About 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium
5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium (PubChem CID 58532023) has the molecular formula C10H18N+
and a molecular weight of 152.26 g/mol. Its IUPAC name is 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium.
Molecular Properties
| Compound Name | 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium |
| PubChem CID | 58532023 |
| Molecular Formula | C10H18N+ |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.14 |
| IUPAC Name | 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium |
| SMILES | CC1=CC(C(C)(C)C)=[N+](C)C1 |
| InChI | InChI=1S/C10H18N/c1-8-6-9(10(2,3)4)11(5)7-8/h6H,7H2,1-5H3/q+1 |
| InChIKey | XZEFOTGSVBQQOZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium?
The IUPAC name of 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium (CID 58532023) is 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium.
What is the SMILES notation for 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium?
The canonical SMILES for 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium is CC1=CC(C(C)(C)C)=[N+](C)C1.
What is the InChIKey of 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium?
The InChIKey is XZEFOTGSVBQQOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N/c1-8-6-9(10(2,3)4)11(5)7-8/h6H,7H2,1-5H3/q+1.
What are the key properties of 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium?
5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium has a molecular weight of 152.26 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1,3-dimethyl-2H-pyrrol-1-ium is sourced from PubChem (CID 58532023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).