C9H12N4 — CID 58532251
3-methyl-5-propylpyrrolo[2,3-e][1,2,4]triazine (PubChem CID 58532251) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-methyl-5-propylpyrrolo[2,3-e][1,2,4]triazine.
| Compound Name | 3-methyl-5-propylpyrrolo[2,3-e][1,2,4]triazine |
|---|---|
| PubChem CID | 58532251 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 3-methyl-5-propylpyrrolo[2,3-e][1,2,4]triazine |
| SMILES | CCCn1ccc2nnc(C)nc21 |
| InChI | InChI=1S/C9H12N4/c1-3-5-13-6-4-8-9(13)10-7(2)11-12-8/h4,6H,3,5H2,1-2H3 |
| InChIKey | YOBZZWDBPKLRGH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |