C23H23Cl2FN6 — CID 58532258
N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine (PubChem CID 58532258) has the molecular formula C23H23Cl2FN6 and a molecular weight of 473.38 g/mol. Its IUPAC name is N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine.
| Compound Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine |
|---|---|
| PubChem CID | 58532258 |
| Molecular Formula | C23H23Cl2FN6 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-[1-(2,6-dichloro-3-fluorophenyl)ethyl]-6-(1-piperidin-4-ylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine |
| SMILES | CC(Nn1ccc2ncc(-c3cnn(C4CCNCC4)c3)cc21)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C23H23Cl2FN6/c1-14(22-18(24)2-3-19(26)23(22)25)30-31-9-6-20-21(31)10-15(11-28-20)16-12-29-32(13-16)17-4-7-27-8-5-17/h2-3,6,9-14,17,27,30H,4-5,7-8H2,1H3 |
| InChIKey | DNWNJZGGQUPTIQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|