About N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine
N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine (PubChem CID 58532381) has the molecular formula C18H14Cl2FN5
and a molecular weight of 390.25 g/mol. Its IUPAC name is N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine.
Molecular Properties
| Compound Name | N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine |
| PubChem CID | 58532381 |
| Molecular Formula | C18H14Cl2FN5 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine |
| SMILES | Cn1cc(-c2cnc3ccn(NCc4c(Cl)ccc(F)c4Cl)c3c2)cn1 |
| InChI | InChI=1S/C18H14Cl2FN5/c1-25-10-12(8-23-25)11-6-17-16(22-7-11)4-5-26(17)24-9-13-14(19)2-3-15(21)18(13)20/h2-8,10,24H,9H2,1H3 |
| InChIKey | DVRCEPBZEBJJRA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine?
The IUPAC name of N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine (CID 58532381) is N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine.
What is the SMILES notation for N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine?
The canonical SMILES for N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine is Cn1cc(-c2cnc3ccn(NCc4c(Cl)ccc(F)c4Cl)c3c2)cn1.
What is the InChIKey of N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine?
The InChIKey is DVRCEPBZEBJJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2FN5/c1-25-10-12(8-23-25)11-6-17-16(22-7-11)4-5-26(17)24-9-13-14(19)2-3-15(21)18(13)20/h2-8,10,24H,9H2,1H3.
What are the key properties of N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine?
N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine has a molecular weight of 390.25 g/mol, XLogP of 4.63, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,6-dichloro-3-fluorophenyl)methyl]-6-(1-methylpyrazol-4-yl)pyrrolo[3,2-b]pyridin-1-amine is sourced from PubChem (CID 58532381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).