C20H23N9OS — CID 58532763
(2,4-dimethyl-1,3-thiazol-5-yl)-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]methanone (PubChem CID 58532763) has the molecular formula C20H23N9OS and a molecular weight of 437.53 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl)-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]methanone.
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl)-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 58532763 |
| Molecular Formula | C20H23N9OS |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl)-[4-[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrrolo[2,1-f][1,2,4]triazin-2-yl]piperazin-1-yl]methanone |
| SMILES | Cc1cc(Nc2nc(N3CCN(C(=O)c4sc(C)nc4C)CC3)nn3cccc23)n[nH]1 |
| InChI | InChI=1S/C20H23N9OS/c1-12-11-16(25-24-12)22-18-15-5-4-6-29(15)26-20(23-18)28-9-7-27(8-10-28)19(30)17-13(2)21-14(3)31-17/h4-6,11H,7-10H2,1-3H3,(H2,22,23,24,25,26) |
| InChIKey | PHRVCELCJLQCKO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |