About 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione
3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione (PubChem CID 58532884) has the molecular formula C15H15F3N2O5S
and a molecular weight of 392.36 g/mol. Its IUPAC name is 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione.
Molecular Properties
| Compound Name | 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| PubChem CID | 58532884 |
| Molecular Formula | C15H15F3N2O5S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| SMILES | CS(=O)(=O)Cn1c(=O)[nH]c2cc(C(F)(F)F)c(C3CCCO3)cc2c1=O |
| InChI | InChI=1S/C15H15F3N2O5S/c1-26(23,24)7-20-13(21)9-5-8(12-3-2-4-25-12)10(15(16,17)18)6-11(9)19-14(20)22/h5-6,12H,2-4,7H2,1H3,(H,19,22) |
| InChIKey | AWKQETBYABLGLX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione?
The IUPAC name of 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione (CID 58532884) is 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione.
What is the SMILES notation for 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione?
The canonical SMILES for 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione is CS(=O)(=O)Cn1c(=O)[nH]c2cc(C(F)(F)F)c(C3CCCO3)cc2c1=O.
What is the InChIKey of 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione?
The InChIKey is AWKQETBYABLGLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3N2O5S/c1-26(23,24)7-20-13(21)9-5-8(12-3-2-4-25-12)10(15(16,17)18)6-11(9)19-14(20)22/h5-6,12H,2-4,7H2,1H3,(H,19,22).
What are the key properties of 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione?
3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione has a molecular weight of 392.36 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylsulfonylmethyl)-6-(oxolan-2-yl)-7-(trifluoromethyl)-1H-quinazoline-2,4-dione is sourced from PubChem (CID 58532884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).