About 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol
1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol (PubChem CID 58533033) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol |
| PubChem CID | 58533033 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)c1cnc2ccccn12 |
| InChI | InChI=1S/C12H16N2O/c1-12(2,3)11(15)9-8-13-10-6-4-5-7-14(9)10/h4-8,11,15H,1-3H3 |
| InChIKey | CUGLRKROVFRMHH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol?
The IUPAC name of 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol (CID 58533033) is 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol?
The canonical SMILES for 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol is CC(C)(C)C(O)c1cnc2ccccn12.
What is the InChIKey of 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol?
The InChIKey is CUGLRKROVFRMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-12(2,3)11(15)9-8-13-10-6-4-5-7-14(9)10/h4-8,11,15H,1-3H3.
What are the key properties of 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol?
1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol has a molecular weight of 204.27 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imidazo[1,2-a]pyridin-3-yl-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 58533033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).