About 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one
7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one (PubChem CID 585332) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one |
| PubChem CID | 585332 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one |
| SMILES | Cc1ccc2c(c1)OC(C(C)C)CC2=O |
| InChI | InChI=1S/C13H16O2/c1-8(2)12-7-11(14)10-5-4-9(3)6-13(10)15-12/h4-6,8,12H,7H2,1-3H3 |
| InChIKey | RSLYWFYUMICTMC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one?
The IUPAC name of 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one (CID 585332) is 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one?
The canonical SMILES for 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one is Cc1ccc2c(c1)OC(C(C)C)CC2=O.
What is the InChIKey of 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one?
The InChIKey is RSLYWFYUMICTMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-8(2)12-7-11(14)10-5-4-9(3)6-13(10)15-12/h4-6,8,12H,7H2,1-3H3.
What are the key properties of 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one?
7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one has a molecular weight of 204.27 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2-propan-2-yl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 585332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).